C20H14Cl2FNO — CID 126214930
1-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]-N-phenylmethanimine (PubChem CID 126214930) has the molecular formula C20H14Cl2FNO and a molecular weight of 374.24 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]-N-phenylmethanimine.
| Compound Name | 1-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]-N-phenylmethanimine |
|---|---|
| PubChem CID | 126214930 |
| Molecular Formula | C20H14Cl2FNO |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 1-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]-N-phenylmethanimine |
| SMILES | Fc1cccc(COc2c(Cl)cc(/C=N/c3ccccc3)cc2Cl)c1 |
| InChI | InChI=1S/C20H14Cl2FNO/c21-18-10-15(12-24-17-7-2-1-3-8-17)11-19(22)20(18)25-13-14-5-4-6-16(23)9-14/h1-12H,13H2/b24-12+ |
| InChIKey | CSYGYFXNWMGLBQ-WYMPLXKRSA-N |
| XLogP | 6.46 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|