C22H19Cl2NO — CID 126209246
1-(3,5-dichloro-4-phenylmethoxyphenyl)-N-(2,3-dimethylphenyl)methanimine (PubChem CID 126209246) has the molecular formula C22H19Cl2NO and a molecular weight of 384.31 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-phenylmethoxyphenyl)-N-(2,3-dimethylphenyl)methanimine.
| Compound Name | 1-(3,5-dichloro-4-phenylmethoxyphenyl)-N-(2,3-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126209246 |
| Molecular Formula | C22H19Cl2NO |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 1-(3,5-dichloro-4-phenylmethoxyphenyl)-N-(2,3-dimethylphenyl)methanimine |
| SMILES | Cc1cccc(/N=C/c2cc(Cl)c(OCc3ccccc3)c(Cl)c2)c1C |
| InChI | InChI=1S/C22H19Cl2NO/c1-15-7-6-10-21(16(15)2)25-13-18-11-19(23)22(20(24)12-18)26-14-17-8-4-3-5-9-17/h3-13H,14H2,1-2H3/b25-13+ |
| InChIKey | UTDHBWPBUFHXLK-DHRITJCHSA-N |
| XLogP | 6.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|