C21H15Cl3N2O3 — CID 126208858
N-(3-chloro-2-methylphenyl)-1-[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methanimine (PubChem CID 126208858) has the molecular formula C21H15Cl3N2O3 and a molecular weight of 449.72 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-1-[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methanimine.
| Compound Name | N-(3-chloro-2-methylphenyl)-1-[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 126208858 |
| Molecular Formula | C21H15Cl3N2O3 |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-1-[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methanimine |
| SMILES | Cc1c(Cl)cccc1/N=C/c1cc(Cl)c(OCc2ccc([N+](=O)[O-])cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl3N2O3/c1-13-17(22)3-2-4-20(13)25-11-15-9-18(23)21(19(24)10-15)29-12-14-5-7-16(8-6-14)26(27)28/h2-11H,12H2,1H3/b25-11+ |
| InChIKey | SLNUMZWOWJLFNT-OPEKNORGSA-N |
| XLogP | 7.19 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|