C28H23FINO3 — CID 126216496
1-[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]-N-(4-phenoxyphenyl)methanimine (PubChem CID 126216496) has the molecular formula C28H23FINO3 and a molecular weight of 567.40 g/mol. Its IUPAC name is 1-[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126216496 |
| Molecular Formula | C28H23FINO3 |
| Molecular Weight | 567.40 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | 1-[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]-N-(4-phenoxyphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc(I)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C28H23FINO3/c1-2-32-27-17-21(16-26(30)28(27)33-19-20-7-6-8-22(29)15-20)18-31-23-11-13-25(14-12-23)34-24-9-4-3-5-10-24/h3-18H,2,19H2,1H3/b31-18+ |
| InChIKey | JUVLXHFNDXDUGD-FDAWAROLSA-N |
| XLogP | 7.95 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.40 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|