C23H20Cl2FNO2 — CID 126217786
1-[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-N-(3-chloro-4-methylphenyl)methanimine (PubChem CID 126217786) has the molecular formula C23H20Cl2FNO2 and a molecular weight of 432.32 g/mol. Its IUPAC name is 1-[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-N-(3-chloro-4-methylphenyl)methanimine.
| Compound Name | 1-[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-N-(3-chloro-4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126217786 |
| Molecular Formula | C23H20Cl2FNO2 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 1-[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-N-(3-chloro-4-methylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(C)c(Cl)c2)cc(Cl)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C23H20Cl2FNO2/c1-3-28-22-11-17(13-27-19-8-7-15(2)20(24)12-19)10-21(25)23(22)29-14-16-5-4-6-18(26)9-16/h4-13H,3,14H2,1-2H3/b27-13+ |
| InChIKey | OLKJHBDZAOXWSO-UVHMKAGCSA-N |
| XLogP | 7.17 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|