C24H21BrClNO4 — CID 126220648
4-[[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126220648) has the molecular formula C24H21BrClNO4 and a molecular weight of 502.79 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126220648 |
| Molecular Formula | C24H21BrClNO4 |
| Molecular Weight | 502.79 g/mol |
| Exact Mass | 501.03 |
| IUPAC Name | 4-[[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=N/c2ccc(C)c(Cl)c2)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H21BrClNO4/c1-3-30-22-11-17(13-27-19-9-4-15(2)21(26)12-19)10-20(25)23(22)31-14-16-5-7-18(8-6-16)24(28)29/h4-13H,3,14H2,1-2H3,(H,28,29)/b27-13+ |
| InChIKey | XLIJDSQCRWYOHL-UVHMKAGCSA-N |
| XLogP | 6.84 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.79 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|