C18H17BrClNO4 — CID 126222878
2-[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]-6-ethoxyphenoxy]acetic acid (PubChem CID 126222878) has the molecular formula C18H17BrClNO4 and a molecular weight of 426.69 g/mol. Its IUPAC name is 2-[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126222878 |
| Molecular Formula | C18H17BrClNO4 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 2-[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(/C=N/c2ccc(C)c(Cl)c2)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C18H17BrClNO4/c1-3-24-16-7-12(6-14(19)18(16)25-10-17(22)23)9-21-13-5-4-11(2)15(20)8-13/h4-9H,3,10H2,1-2H3,(H,22,23)/b21-9+ |
| InChIKey | NUPUEKDOHZFZDM-ZVBGSRNCSA-N |
| XLogP | 5.02 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|