C16H13BrClNO3 — CID 126206778
2-[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]acetic acid (PubChem CID 126206778) has the molecular formula C16H13BrClNO3 and a molecular weight of 382.64 g/mol. Its IUPAC name is 2-[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126206778 |
| Molecular Formula | C16H13BrClNO3 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 2-[2-bromo-4-[(3-chloro-4-methylphenyl)iminomethyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(/N=C/c2ccc(OCC(=O)O)c(Br)c2)cc1Cl |
| InChI | InChI=1S/C16H13BrClNO3/c1-10-2-4-12(7-14(10)18)19-8-11-3-5-15(13(17)6-11)22-9-16(20)21/h2-8H,9H2,1H3,(H,20,21)/b19-8+ |
| InChIKey | IERPSLDPYQGEAA-UFWORHAWSA-N |
| XLogP | 4.62 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|