C22H18Cl2FNO2 — CID 126218474
1-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]-N-(4-ethoxyphenyl)methanimine (PubChem CID 126218474) has the molecular formula C22H18Cl2FNO2 and a molecular weight of 418.30 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126218474 |
| Molecular Formula | C22H18Cl2FNO2 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 1-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/N=C/c2cc(Cl)c(OCc3cccc(F)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H18Cl2FNO2/c1-2-27-19-8-6-18(7-9-19)26-13-16-11-20(23)22(21(24)12-16)28-14-15-4-3-5-17(25)10-15/h3-13H,2,14H2,1H3/b26-13+ |
| InChIKey | PGGIMMYGZBZRNM-LGJNPRDNSA-N |
| XLogP | 6.86 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|