C23H22FNO3 — CID 4736660
N-(4-ethoxyphenyl)-1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine (PubChem CID 4736660) has the molecular formula C23H22FNO3 and a molecular weight of 379.43 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine.
| Compound Name | N-(4-ethoxyphenyl)-1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine |
|---|---|
| PubChem CID | 4736660 |
| Molecular Formula | C23H22FNO3 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine |
| SMILES | CCOc1ccc(/N=C/c2ccc(OCc3ccc(F)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H22FNO3/c1-3-27-21-11-9-20(10-12-21)25-15-18-6-13-22(23(14-18)26-2)28-16-17-4-7-19(24)8-5-17/h4-15H,3,16H2,1-2H3/b25-15+ |
| InChIKey | BJWJNDGHFDIWJL-MFKUBSTISA-N |
| XLogP | 5.56 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|