C26H18Cl3NO2 — CID 126224806
1-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-N-(4-phenoxyphenyl)methanimine (PubChem CID 126224806) has the molecular formula C26H18Cl3NO2 and a molecular weight of 482.79 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126224806 |
| Molecular Formula | C26H18Cl3NO2 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 1-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-N-(4-phenoxyphenyl)methanimine |
| SMILES | Clc1ccccc1COc1c(Cl)cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C26H18Cl3NO2/c27-23-9-5-4-6-19(23)17-31-26-24(28)14-18(15-25(26)29)16-30-20-10-12-22(13-11-20)32-21-7-2-1-3-8-21/h1-16H,17H2/b30-16+ |
| InChIKey | WDLXCLUFNOSIBW-OKCVXOCRSA-N |
| XLogP | 8.77 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|