C18H12Cl2N2O2 — CID 126166181
2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-4,5-dimethylfuran-3-carbonitrile (PubChem CID 126166181) has the molecular formula C18H12Cl2N2O2 and a molecular weight of 359.21 g/mol. Its IUPAC name is 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-4,5-dimethylfuran-3-carbonitrile.
| Compound Name | 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-4,5-dimethylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 126166181 |
| Molecular Formula | C18H12Cl2N2O2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-4,5-dimethylfuran-3-carbonitrile |
| SMILES | Cc1oc(N=Cc2ccc(-c3cc(Cl)ccc3Cl)o2)c(C#N)c1C |
| InChI | InChI=1S/C18H12Cl2N2O2/c1-10-11(2)23-18(15(10)8-21)22-9-13-4-6-17(24-13)14-7-12(19)3-5-16(14)20/h3-7,9H,1-2H3 |
| InChIKey | BKHQVRIAYBWFCZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 62.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|