C13H8Cl2N4O — CID 659930
1-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine (PubChem CID 659930) has the molecular formula C13H8Cl2N4O and a molecular weight of 307.14 g/mol. Its IUPAC name is 1-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine.
| Compound Name | 1-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine |
|---|---|
| PubChem CID | 659930 |
| Molecular Formula | C13H8Cl2N4O |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 1-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine |
| SMILES | Clc1ccc(Cl)c(-c2ccc(C=Nc3ncn[nH]3)o2)c1 |
| InChI | InChI=1S/C13H8Cl2N4O/c14-8-1-3-11(15)10(5-8)12-4-2-9(20-12)6-16-13-17-7-18-19-13/h1-7H,(H,17,18,19) |
| InChIKey | KTELCJHOASDSAF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|