C13H9N5O3 — CID 3834790
1-[5-(3-nitrophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine (PubChem CID 3834790) has the molecular formula C13H9N5O3 and a molecular weight of 283.25 g/mol. Its IUPAC name is 1-[5-(3-nitrophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine.
| Compound Name | 1-[5-(3-nitrophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine |
|---|---|
| PubChem CID | 3834790 |
| Molecular Formula | C13H9N5O3 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 1-[5-(3-nitrophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc(C=Nc3ncn[nH]3)o2)c1 |
| InChI | InChI=1S/C13H9N5O3/c19-18(20)10-3-1-2-9(6-10)12-5-4-11(21-12)7-14-13-15-8-16-17-13/h1-8H,(H,15,16,17) |
| InChIKey | JEVDNBCJGDZDFD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|