C23H13BrN4O4 — CID 56693333
N-[2-(2-bromo-4-pyridinyl)-1,3-benzoxazol-5-yl]-1-[5-(3-nitrophenyl)furan-2-yl]methanimine (PubChem CID 56693333) has the molecular formula C23H13BrN4O4 and a molecular weight of 489.29 g/mol. Its IUPAC name is N-[2-(2-bromo-4-pyridinyl)-1,3-benzoxazol-5-yl]-1-[5-(3-nitrophenyl)furan-2-yl]methanimine.
| Compound Name | N-[2-(2-bromo-4-pyridinyl)-1,3-benzoxazol-5-yl]-1-[5-(3-nitrophenyl)furan-2-yl]methanimine |
|---|---|
| PubChem CID | 56693333 |
| Molecular Formula | C23H13BrN4O4 |
| Molecular Weight | 489.29 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | N-[2-(2-bromo-4-pyridinyl)-1,3-benzoxazol-5-yl]-1-[5-(3-nitrophenyl)furan-2-yl]methanimine |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc(/C=N/c3ccc4oc(-c5ccnc(Br)c5)nc4c3)o2)c1 |
| InChI | InChI=1S/C23H13BrN4O4/c24-22-11-15(8-9-25-22)23-27-19-12-16(4-6-21(19)32-23)26-13-18-5-7-20(31-18)14-2-1-3-17(10-14)28(29)30/h1-13H/b26-13+ |
| InChIKey | RRUKYPYNMVIPCZ-LGJNPRDNSA-N |
| XLogP | 6.57 |
| TPSA | 107.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.29 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|