C23H14N4O4 — CID 5049071
1-[5-(4-nitrophenyl)furan-2-yl]-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)methanimine (PubChem CID 5049071) has the molecular formula C23H14N4O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)furan-2-yl]-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)methanimine.
| Compound Name | 1-[5-(4-nitrophenyl)furan-2-yl]-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)methanimine |
|---|---|
| PubChem CID | 5049071 |
| Molecular Formula | C23H14N4O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[5-(4-nitrophenyl)furan-2-yl]-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(/C=N/c3ccc4oc(-c5ccncc5)nc4c3)o2)cc1 |
| InChI | InChI=1S/C23H14N4O4/c28-27(29)18-4-1-15(2-5-18)21-8-6-19(30-21)14-25-17-3-7-22-20(13-17)26-23(31-22)16-9-11-24-12-10-16/h1-14H/b25-14+ |
| InChIKey | BYMOTRPPIBCQDS-AFUMVMLFSA-N |
| XLogP | 5.81 |
| TPSA | 107.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|