C24H12Cl3IN2O2 — CID 171982573
N-[2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]-1-[5-(3,4-dichlorophenyl)furan-2-yl]methanimine (PubChem CID 171982573) has the molecular formula C24H12Cl3IN2O2 and a molecular weight of 593.64 g/mol. Its IUPAC name is N-[2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]-1-[5-(3,4-dichlorophenyl)furan-2-yl]methanimine.
| Compound Name | N-[2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]-1-[5-(3,4-dichlorophenyl)furan-2-yl]methanimine |
|---|---|
| PubChem CID | 171982573 |
| Molecular Formula | C24H12Cl3IN2O2 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 591.90 |
| IUPAC Name | N-[2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]-1-[5-(3,4-dichlorophenyl)furan-2-yl]methanimine |
| SMILES | Clc1ccc(-c2ccc(/C=N/c3ccc4oc(-c5cc(I)ccc5Cl)nc4c3)o2)cc1Cl |
| InChI | InChI=1S/C24H12Cl3IN2O2/c25-18-6-2-14(28)10-17(18)24-30-21-11-15(3-7-23(21)32-24)29-12-16-4-8-22(31-16)13-1-5-19(26)20(27)9-13/h1-12H/b29-12+ |
| InChIKey | MYUNIUWIGXVGFZ-XKJRVUDJSA-N |
| XLogP | 9.07 |
| TPSA | 51.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|