C14H9ClINO2 — CID 91681454
[2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]methanol (PubChem CID 91681454) has the molecular formula C14H9ClINO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is [2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]methanol.
| Compound Name | [2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]methanol |
|---|---|
| PubChem CID | 91681454 |
| Molecular Formula | C14H9ClINO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | [2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]methanol |
| SMILES | OCc1ccc2oc(-c3cc(I)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C14H9ClINO2/c15-11-3-2-9(16)6-10(11)14-17-12-5-8(7-18)1-4-13(12)19-14/h1-6,18H,7H2 |
| InChIKey | SKROEZXDHMAHQX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|