C12H8BrNO3 — CID 82357873
[2-(5-bromofuran-2-yl)-1,3-benzoxazol-5-yl]methanol (PubChem CID 82357873) has the molecular formula C12H8BrNO3 and a molecular weight of 294.10 g/mol. Its IUPAC name is [2-(5-bromofuran-2-yl)-1,3-benzoxazol-5-yl]methanol.
| Compound Name | [2-(5-bromofuran-2-yl)-1,3-benzoxazol-5-yl]methanol |
|---|---|
| PubChem CID | 82357873 |
| Molecular Formula | C12H8BrNO3 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | [2-(5-bromofuran-2-yl)-1,3-benzoxazol-5-yl]methanol |
| SMILES | OCc1ccc2oc(-c3ccc(Br)o3)nc2c1 |
| InChI | InChI=1S/C12H8BrNO3/c13-11-4-3-10(16-11)12-14-8-5-7(6-15)1-2-9(8)17-12/h1-5,15H,6H2 |
| InChIKey | FQPKPOFCGWVXRE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |