C12H13NO3 — CID 82357843
[2-(oxolan-2-yl)-1,3-benzoxazol-5-yl]methanol (PubChem CID 82357843) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is [2-(oxolan-2-yl)-1,3-benzoxazol-5-yl]methanol.
| Compound Name | [2-(oxolan-2-yl)-1,3-benzoxazol-5-yl]methanol |
|---|---|
| PubChem CID | 82357843 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | [2-(oxolan-2-yl)-1,3-benzoxazol-5-yl]methanol |
| SMILES | OCc1ccc2oc(C3CCCO3)nc2c1 |
| InChI | InChI=1S/C12H13NO3/c14-7-8-3-4-10-9(6-8)13-12(16-10)11-2-1-5-15-11/h3-4,6,11,14H,1-2,5,7H2 |
| InChIKey | JCQOUTHNIDPCIH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |