C14H18N2O2 — CID 82357724
N-[[2-(oxolan-2-yl)-1,3-benzoxazol-5-yl]methyl]ethanamine (PubChem CID 82357724) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-[[2-(oxolan-2-yl)-1,3-benzoxazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[2-(oxolan-2-yl)-1,3-benzoxazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 82357724 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-[[2-(oxolan-2-yl)-1,3-benzoxazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1ccc2oc(C3CCCO3)nc2c1 |
| InChI | InChI=1S/C14H18N2O2/c1-2-15-9-10-5-6-12-11(8-10)16-14(18-12)13-4-3-7-17-13/h5-6,8,13,15H,2-4,7,9H2,1H3 |
| InChIKey | DVBAETOGKPQYSP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |