C13H13NO2 — CID 82284648
1-(2-cyclopropyl-1,3-benzoxazol-5-yl)propan-1-one (PubChem CID 82284648) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)propan-1-one.
| Compound Name | 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 82284648 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)propan-1-one |
| SMILES | CCC(=O)c1ccc2oc(C3CC3)nc2c1 |
| InChI | InChI=1S/C13H13NO2/c1-2-11(15)9-5-6-12-10(7-9)14-13(16-12)8-3-4-8/h5-8H,2-4H2,1H3 |
| InChIKey | CUAPLYPUNHXLQO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |