C14H17NO2 — CID 178176303
1-(2-cyclopropyl-1,3-benzoxazol-5-yl)ethanone;ethane (PubChem CID 178176303) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)ethanone;ethane.
| Compound Name | 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)ethanone;ethane |
|---|---|
| PubChem CID | 178176303 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-benzoxazol-5-yl)ethanone;ethane |
| SMILES | CC.CC(=O)c1ccc2oc(C3CC3)nc2c1 |
| InChI | InChI=1S/C12H11NO2.C2H6/c1-7(14)9-4-5-11-10(6-9)13-12(15-11)8-2-3-8;1-2/h4-6,8H,2-3H2,1H3;1-2H3 |
| InChIKey | WTHXPWDWPDKJLP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |