C16H19NO2 — CID 82299964
1-(2-cyclohexyl-1,3-benzoxazol-5-yl)propan-1-one (PubChem CID 82299964) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-(2-cyclohexyl-1,3-benzoxazol-5-yl)propan-1-one.
| Compound Name | 1-(2-cyclohexyl-1,3-benzoxazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 82299964 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(2-cyclohexyl-1,3-benzoxazol-5-yl)propan-1-one |
| SMILES | CCC(=O)c1ccc2oc(C3CCCCC3)nc2c1 |
| InChI | InChI=1S/C16H19NO2/c1-2-14(18)12-8-9-15-13(10-12)17-16(19-15)11-6-4-3-5-7-11/h8-11H,2-7H2,1H3 |
| InChIKey | MEZSFLYKCWZVLV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |