C15H17NO3 — CID 54270263
2-(2-cyclohexyl-1,3-benzoxazol-6-yl)acetic acid (PubChem CID 54270263) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1,3-benzoxazol-6-yl)acetic acid.
| Compound Name | 2-(2-cyclohexyl-1,3-benzoxazol-6-yl)acetic acid |
|---|---|
| PubChem CID | 54270263 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(2-cyclohexyl-1,3-benzoxazol-6-yl)acetic acid |
| SMILES | O=C(O)Cc1ccc2nc(C3CCCCC3)oc2c1 |
| InChI | InChI=1S/C15H17NO3/c17-14(18)9-10-6-7-12-13(8-10)19-15(16-12)11-4-2-1-3-5-11/h6-8,11H,1-5,9H2,(H,17,18) |
| InChIKey | RJPQYRSNQVZBNQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |