C14H11NO2S — CID 82299953
1-(2-thiophen-2-yl-1,3-benzoxazol-5-yl)propan-1-one (PubChem CID 82299953) has the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. Its IUPAC name is 1-(2-thiophen-2-yl-1,3-benzoxazol-5-yl)propan-1-one.
| Compound Name | 1-(2-thiophen-2-yl-1,3-benzoxazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 82299953 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 1-(2-thiophen-2-yl-1,3-benzoxazol-5-yl)propan-1-one |
| SMILES | CCC(=O)c1ccc2oc(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C14H11NO2S/c1-2-11(16)9-5-6-12-10(8-9)15-14(17-12)13-4-3-7-18-13/h3-8H,2H2,1H3 |
| InChIKey | XXEXMXVSZHQHOL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |