C32H14N4O4S2 — CID 169314270
2-thiophen-2-yl-7-(2-thiophen-2-yl-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-7-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole (PubChem CID 169314270) has the molecular formula C32H14N4O4S2 and a molecular weight of 582.62 g/mol. Its IUPAC name is 2-thiophen-2-yl-7-(2-thiophen-2-yl-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-7-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole.
| Compound Name | 2-thiophen-2-yl-7-(2-thiophen-2-yl-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-7-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 169314270 |
| Molecular Formula | C32H14N4O4S2 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | 2-thiophen-2-yl-7-(2-thiophen-2-yl-[1,3]benzoxazolo[6,5-f][1,3]benzoxazol-7-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
| SMILES | c1csc(-c2nc3cc4cc5oc(-c6nc7cc8cc9oc(-c%10cccs%10)nc9cc8cc7o6)nc5cc4cc3o2)c1 |
| InChI | InChI=1S/C32H14N4O4S2/c1-3-27(41-5-1)29-33-19-7-15-13-25-21(9-17(15)11-23(19)37-29)35-31(39-25)32-36-22-10-18-12-24-20(8-16(18)14-26(22)40-32)34-30(38-24)28-4-2-6-42-28/h1-14H |
| InChIKey | PMFBCZSHCVGTAZ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 104.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |