C28H14N6O2S2 — CID 169314279
2,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole (PubChem CID 169314279) has the molecular formula C28H14N6O2S2 and a molecular weight of 530.59 g/mol. Its IUPAC name is 2,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole.
| Compound Name | 2,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 169314279 |
| Molecular Formula | C28H14N6O2S2 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 2,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-[1,3]benzoxazolo[6,5-f][1,3]benzoxazole |
| SMILES | c1ncc(-c2ccc(-c3nc4cc5cc6oc(-c7ccc(-c8cncnc8)s7)nc6cc5cc4o3)s2)cn1 |
| InChI | InChI=1S/C28H14N6O2S2/c1-3-25(37-23(1)17-9-29-13-30-10-17)27-33-19-5-15-8-22-20(6-16(15)7-21(19)35-27)34-28(36-22)26-4-2-24(38-26)18-11-31-14-32-12-18/h1-14H |
| InChIKey | AIKUPYDQYAUQFA-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |