C16H12FNO2 — CID 82305496
1-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]propan-1-one (PubChem CID 82305496) has the molecular formula C16H12FNO2 and a molecular weight of 269.27 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]propan-1-one.
| Compound Name | 1-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 82305496 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]propan-1-one |
| SMILES | CCC(=O)c1ccc2oc(-c3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C16H12FNO2/c1-2-14(19)10-6-7-15-13(9-10)18-16(20-15)11-4-3-5-12(17)8-11/h3-9H,2H2,1H3 |
| InChIKey | ICGCRWUGOIPFQQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |