C11H11NO2 — CID 122232513
2-[(2R)-oxolan-2-yl]-1,3-benzoxazole (PubChem CID 122232513) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-[(2R)-oxolan-2-yl]-1,3-benzoxazole.
| Compound Name | 2-[(2R)-oxolan-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 122232513 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-[(2R)-oxolan-2-yl]-1,3-benzoxazole |
| SMILES | c1ccc2oc([C@H]3CCCO3)nc2c1 |
| InChI | InChI=1S/C11H11NO2/c1-2-5-9-8(4-1)12-11(14-9)10-6-3-7-13-10/h1-2,4-5,10H,3,6-7H2/t10-/m1/s1 |
| InChIKey | AJDIXSVEHLGXEP-SNVBAGLBSA-N |
| XLogP | 2.68 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |