C15H11NO3 — CID 174524376
2-(3,4-dihydro-1,2-benzodioxin-3-yl)-1,3-benzoxazole (PubChem CID 174524376) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-(3,4-dihydro-1,2-benzodioxin-3-yl)-1,3-benzoxazole.
| Compound Name | 2-(3,4-dihydro-1,2-benzodioxin-3-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 174524376 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(3,4-dihydro-1,2-benzodioxin-3-yl)-1,3-benzoxazole |
| SMILES | c1ccc2c(c1)CC(c1nc3ccccc3o1)OO2 |
| InChI | InChI=1S/C15H11NO3/c1-3-7-12-10(5-1)9-14(19-18-12)15-16-11-6-2-4-8-13(11)17-15/h1-8,14H,9H2 |
| InChIKey | OAQMYFUKBPXUET-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|