C15H17NO — CID 132604219
2-[(2Z)-cyclooct-2-en-1-yl]-1,3-benzoxazole (PubChem CID 132604219) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[(2Z)-cyclooct-2-en-1-yl]-1,3-benzoxazole.
| Compound Name | 2-[(2Z)-cyclooct-2-en-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 132604219 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-[(2Z)-cyclooct-2-en-1-yl]-1,3-benzoxazole |
| SMILES | C1=C\C(c2nc3ccccc3o2)CCCCC/1 |
| InChI | InChI=1S/C15H17NO/c1-2-4-8-12(9-5-3-1)15-16-13-10-6-7-11-14(13)17-15/h4,6-8,10-12H,1-3,5,9H2/b8-4- |
| InChIKey | NRZDFKAZKZCMLA-YWEYNIOJSA-N |
| XLogP | 4.43 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|