C16H23N3O — CID 115306743
N'-(1,3-benzoxazol-2-yl)-N-cycloheptylethane-1,2-diamine (PubChem CID 115306743) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N'-(1,3-benzoxazol-2-yl)-N-cycloheptylethane-1,2-diamine.
| Compound Name | N'-(1,3-benzoxazol-2-yl)-N-cycloheptylethane-1,2-diamine |
|---|---|
| PubChem CID | 115306743 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N'-(1,3-benzoxazol-2-yl)-N-cycloheptylethane-1,2-diamine |
| SMILES | c1ccc2oc(NCCNC3CCCCCC3)nc2c1 |
| InChI | InChI=1S/C16H23N3O/c1-2-4-8-13(7-3-1)17-11-12-18-16-19-14-9-5-6-10-15(14)20-16/h5-6,9-10,13,17H,1-4,7-8,11-12H2,(H,18,19) |
| InChIKey | KNNGUEWRFKFFSF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|