C11H13ClN2O — CID 106845081
N-(4-chlorobutyl)-1,3-benzoxazol-2-amine (PubChem CID 106845081) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is N-(4-chlorobutyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(4-chlorobutyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 106845081 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-(4-chlorobutyl)-1,3-benzoxazol-2-amine |
| SMILES | ClCCCCNc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H13ClN2O/c12-7-3-4-8-13-11-14-9-5-1-2-6-10(9)15-11/h1-2,5-6H,3-4,7-8H2,(H,13,14) |
| InChIKey | ISVFAHZHMDBPSC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|