C17H17Cl2N3O — CID 70693739
N'-(1,3-benzoxazol-2-yl)-N-[(2,4-dichlorophenyl)methyl]propane-1,3-diamine (PubChem CID 70693739) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is N'-(1,3-benzoxazol-2-yl)-N-[(2,4-dichlorophenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-(1,3-benzoxazol-2-yl)-N-[(2,4-dichlorophenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 70693739 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N'-(1,3-benzoxazol-2-yl)-N-[(2,4-dichlorophenyl)methyl]propane-1,3-diamine |
| SMILES | Clc1ccc(CNCCCNc2nc3ccccc3o2)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O/c18-13-7-6-12(14(19)10-13)11-20-8-3-9-21-17-22-15-4-1-2-5-16(15)23-17/h1-2,4-7,10,20H,3,8-9,11H2,(H,21,22) |
| InChIKey | PLEBZGXKFNGAFZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|