C17H14Cl2N2O2 — CID 9427574
3-(1,3-benzoxazol-2-yl)-N-[(2,4-dichlorophenyl)methyl]propanamide (PubChem CID 9427574) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-N-[(2,4-dichlorophenyl)methyl]propanamide.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-N-[(2,4-dichlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 9427574 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-N-[(2,4-dichlorophenyl)methyl]propanamide |
| SMILES | O=C(CCc1nc2ccccc2o1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O2/c18-12-6-5-11(13(19)9-12)10-20-16(22)7-8-17-21-14-3-1-2-4-15(14)23-17/h1-6,9H,7-8,10H2,(H,20,22) |
| InChIKey | FOZQWPLAWTXGAL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |