C12H15N3O2 — CID 87717718
N-[4-(1,3-benzoxazol-2-ylamino)butyl]formamide (PubChem CID 87717718) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-ylamino)butyl]formamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-ylamino)butyl]formamide |
|---|---|
| PubChem CID | 87717718 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-ylamino)butyl]formamide |
| SMILES | O=CNCCCCNc1nc2ccccc2o1 |
| InChI | InChI=1S/C12H15N3O2/c16-9-13-7-3-4-8-14-12-15-10-5-1-2-6-11(10)17-12/h1-2,5-6,9H,3-4,7-8H2,(H,13,16)(H,14,15) |
| InChIKey | JCLOKSIXIXDOKK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|