C8H7N3O2 — CID 15893148
N-(1,3-benzoxazol-2-ylamino)formamide (PubChem CID 15893148) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is N-(1,3-benzoxazol-2-ylamino)formamide.
| Compound Name | N-(1,3-benzoxazol-2-ylamino)formamide |
|---|---|
| PubChem CID | 15893148 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | N-(1,3-benzoxazol-2-ylamino)formamide |
| SMILES | O=CNNc1nc2ccccc2o1 |
| InChI | InChI=1S/C8H7N3O2/c12-5-9-11-8-10-6-3-1-2-4-7(6)13-8/h1-5H,(H,9,12)(H,10,11) |
| InChIKey | QQFRYMATMVNXEZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|