C13H13N3O — CID 79106270
N-(2,5-dimethylpyrrol-1-yl)-1,3-benzoxazol-2-amine (PubChem CID 79106270) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is N-(2,5-dimethylpyrrol-1-yl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(2,5-dimethylpyrrol-1-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 79106270 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(2,5-dimethylpyrrol-1-yl)-1,3-benzoxazol-2-amine |
| SMILES | Cc1ccc(C)n1Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C13H13N3O/c1-9-7-8-10(2)16(9)15-13-14-11-5-3-4-6-12(11)17-13/h3-8H,1-2H3,(H,14,15) |
| InChIKey | JLSGBJLZNAYFTI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |