C17H21N3O — CID 137482565
1-(2-adamantyl)-2-(1,3-benzoxazol-2-yl)hydrazine (PubChem CID 137482565) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(2-adamantyl)-2-(1,3-benzoxazol-2-yl)hydrazine.
| Compound Name | 1-(2-adamantyl)-2-(1,3-benzoxazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 137482565 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-(2-adamantyl)-2-(1,3-benzoxazol-2-yl)hydrazine |
| SMILES | c1ccc2oc(NNC3C4CC5CC(C4)CC3C5)nc2c1 |
| InChI | InChI=1S/C17H21N3O/c1-2-4-15-14(3-1)18-17(21-15)20-19-16-12-6-10-5-11(8-12)9-13(16)7-10/h1-4,10-13,16,19H,5-9H2,(H,18,20) |
| InChIKey | FOYXRHIUHKLFNM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|