C18H19NO — CID 139949900
2-(2-adamantylidenemethyl)-1,3-benzoxazole (PubChem CID 139949900) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(2-adamantylidenemethyl)-1,3-benzoxazole.
| Compound Name | 2-(2-adamantylidenemethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 139949900 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-(2-adamantylidenemethyl)-1,3-benzoxazole |
| SMILES | C(=C1C2CC3CC(C2)CC1C3)c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H19NO/c1-2-4-17-16(3-1)19-18(20-17)10-15-13-6-11-5-12(8-13)9-14(15)7-11/h1-4,10-14H,5-9H2/b15-10- |
| InChIKey | JOEMZZBXHFAOQW-GDNBJRDFSA-N |
| XLogP | 4.67 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |