C18H22N2O3 — CID 122499410
[4-(1,3-benzoxazol-2-ylamino)-1-adamantyl]methanediol (PubChem CID 122499410) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [4-(1,3-benzoxazol-2-ylamino)-1-adamantyl]methanediol.
| Compound Name | [4-(1,3-benzoxazol-2-ylamino)-1-adamantyl]methanediol |
|---|---|
| PubChem CID | 122499410 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [4-(1,3-benzoxazol-2-ylamino)-1-adamantyl]methanediol |
| SMILES | OC(O)C12CC3CC(C1)C(Nc1nc4ccccc4o1)C(C3)C2 |
| InChI | InChI=1S/C18H22N2O3/c21-16(22)18-7-10-5-11(8-18)15(12(6-10)9-18)20-17-19-13-3-1-2-4-14(13)23-17/h1-4,10-12,15-16,21-22H,5-9H2,(H,19,20) |
| InChIKey | VVBUIKOYCKQGPY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|