C16H20N2O3 — CID 125137648
N-[(1S,3R,4S)-3-ethoxy-5-oxaspiro[3.4]octan-1-yl]-1,3-benzoxazol-2-amine (PubChem CID 125137648) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[(1S,3R,4S)-3-ethoxy-5-oxaspiro[3.4]octan-1-yl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(1S,3R,4S)-3-ethoxy-5-oxaspiro[3.4]octan-1-yl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 125137648 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[(1S,3R,4S)-3-ethoxy-5-oxaspiro[3.4]octan-1-yl]-1,3-benzoxazol-2-amine |
| SMILES | CCO[C@@H]1C[C@H](Nc2nc3ccccc3o2)[C@@]12CCCO2 |
| InChI | InChI=1S/C16H20N2O3/c1-2-19-14-10-13(16(14)8-5-9-20-16)18-15-17-11-6-3-4-7-12(11)21-15/h3-4,6-7,13-14H,2,5,8-10H2,1H3,(H,17,18)/t13-,14+,16-/m0/s1 |
| InChIKey | LXCCOBAJJFPTJH-LZWOXQAQSA-N |
| XLogP | 2.97 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |