C18H18N2O2 — CID 97258798
N-[(1S,2S)-2-(3-ethoxyphenyl)cyclopropyl]-1,3-benzoxazol-2-amine (PubChem CID 97258798) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[(1S,2S)-2-(3-ethoxyphenyl)cyclopropyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(1S,2S)-2-(3-ethoxyphenyl)cyclopropyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 97258798 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[(1S,2S)-2-(3-ethoxyphenyl)cyclopropyl]-1,3-benzoxazol-2-amine |
| SMILES | CCOc1cccc([C@@H]2C[C@@H]2Nc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C18H18N2O2/c1-2-21-13-7-5-6-12(10-13)14-11-16(14)20-18-19-15-8-3-4-9-17(15)22-18/h3-10,14,16H,2,11H2,1H3,(H,19,20)/t14-,16-/m0/s1 |
| InChIKey | MQPWXJIQADSDST-HOCLYGCPSA-N |
| XLogP | 4.19 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |