C16H23N3O — CID 122082396
1-cyclopropyl-3-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylguanidine (PubChem CID 122082396) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylguanidine.
| Compound Name | 1-cyclopropyl-3-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 122082396 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-cyclopropyl-3-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylguanidine |
| SMILES | CCOc1cccc([C@@H]2C[C@H]2N/C(=N/C)NC2CC2)c1 |
| InChI | InChI=1S/C16H23N3O/c1-3-20-13-6-4-5-11(9-13)14-10-15(14)19-16(17-2)18-12-7-8-12/h4-6,9,12,14-15H,3,7-8,10H2,1-2H3,(H2,17,18,19)/t14-,15+/m0/s1 |
| InChIKey | UAOUEIRXRDSEHK-LSDHHAIUSA-N |
| XLogP | 2.27 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|