C24H33IN4O2 — CID 109387206
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(2-phenylcyclopropyl)guanidine;hydroiodide (PubChem CID 109387206) has the molecular formula C24H33IN4O2 and a molecular weight of 536.46 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(2-phenylcyclopropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(2-phenylcyclopropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109387206 |
| Molecular Formula | C24H33IN4O2 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(2-phenylcyclopropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NC1CCN(c2cc(OC)cc(OC)c2)CC1)NC1CC1c1ccccc1.I |
| InChI | InChI=1S/C24H32N4O2.HI/c1-25-24(27-23-16-22(23)17-7-5-4-6-8-17)26-18-9-11-28(12-10-18)19-13-20(29-2)15-21(14-19)30-3;/h4-8,13-15,18,22-23H,9-12,16H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | APCZFELMPQDFOB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|