C22H30IN5O4 — CID 109388658
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 109388658) has the molecular formula C22H30IN5O4 and a molecular weight of 555.42 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109388658 |
| Molecular Formula | C22H30IN5O4 |
| Molecular Weight | 555.42 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1[N+](=O)[O-])NC1CCN(c2cc(OC)cc(OC)c2)CC1.I |
| InChI | InChI=1S/C22H29N5O4.HI/c1-23-22(24-15-16-6-4-5-7-21(16)27(28)29)25-17-8-10-26(11-9-17)18-12-19(30-2)14-20(13-18)31-3;/h4-7,12-14,17H,8-11,15H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | HOOJXCJWCAHWRX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|