C25H31N5O2 — CID 109387524
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(quinolin-8-ylmethyl)guanidine (PubChem CID 109387524) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(quinolin-8-ylmethyl)guanidine.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(quinolin-8-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109387524 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-(quinolin-8-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1cccc2cccnc12)NC1CCN(c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C25H31N5O2/c1-26-25(28-17-19-7-4-6-18-8-5-11-27-24(18)19)29-20-9-12-30(13-10-20)21-14-22(31-2)16-23(15-21)32-3/h4-8,11,14-16,20H,9-10,12-13,17H2,1-3H3,(H2,26,28,29) |
| InChIKey | UXYDUMVQFIIGDN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|