C12H14N2O2 — CID 104576711
N-(3-methoxycyclobutyl)-1,3-benzoxazol-2-amine (PubChem CID 104576711) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-(3-methoxycyclobutyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(3-methoxycyclobutyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 104576711 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-(3-methoxycyclobutyl)-1,3-benzoxazol-2-amine |
| SMILES | COC1CC(Nc2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C12H14N2O2/c1-15-9-6-8(7-9)13-12-14-10-4-2-3-5-11(10)16-12/h2-5,8-9H,6-7H2,1H3,(H,13,14) |
| InChIKey | OJPFYGYNVLLUCC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |