C15H15N3O — CID 63120269
N'-(1,3-benzoxazol-2-yl)-1-phenylethane-1,2-diamine (PubChem CID 63120269) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is N'-(1,3-benzoxazol-2-yl)-1-phenylethane-1,2-diamine.
| Compound Name | N'-(1,3-benzoxazol-2-yl)-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 63120269 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N'-(1,3-benzoxazol-2-yl)-1-phenylethane-1,2-diamine |
| SMILES | NC(CNc1nc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C15H15N3O/c16-12(11-6-2-1-3-7-11)10-17-15-18-13-8-4-5-9-14(13)19-15/h1-9,12H,10,16H2,(H,17,18) |
| InChIKey | UFGSIPPBGGCIMU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |